טוען...
Synthesis, Characterization, and Electrochemistry of Diferrocenyl β-Diketones, -Diketonates, and Pyrazoles †
The synthesis of FcC(O)CH(R)C(O)Fc (Fc = Fe(η(5)-C(5)H(4))(η(5)-C(5)H(5)); R = H, 5; (n)Bu, 7; CH(2)CH(2)(OCH(2)CH(2))(2)OMe, 9), [M(κ(2)O,O′-FcC(O)CHC(O)Fc)(n)] (M = Ti, n = 3, 10; M = Fe, n = 3, 11; M = BF(2), n = 1, 12), and 1-R′-3,5-Fc(2)-(c)C(3)HN(2) (R′ = H, 13; Me, 14; Ph, 15) is discussed. T...
שמור ב:
| הוצא לאור ב: | Molecules |
|---|---|
| Main Authors: | , , , , , |
| פורמט: | Artigo |
| שפה: | Inglês |
| יצא לאור: |
MDPI
2020
|
| נושאים: | |
| גישה מקוונת: | https://ncbi.nlm.nih.gov/pmc/articles/PMC7583057/ https://ncbi.nlm.nih.gov/pubmed/33003450 https://ncbi.nlm.nih.govhttp://dx.doi.org/10.3390/molecules25194476 |
| תגים: |
הוספת תג
אין תגיות, היה/י הראשונ/ה לתייג את הרשומה!
|