A carregar...
N,N′-Dimethyl-N′′-(trichloroacetyl)phosphoramide
In the title compound, C(4)H(9)Cl(3)N(3)O(2)P or CCl(3)C(O)NHP(O)(NHCH(3))(2), the P atom has a strongly distorted tetrahedral geometry due to the formation of intermolecular strong hydrogen bonds involving the N atoms. In the crystal, N—H⋯O=P and N—H⋯O=C hydrogen bonds connect the molecules into...
Na minha lista:
| Autor principal: | |
|---|---|
| Formato: | Artigo |
| Idioma: | Inglês |
| Publicado em: |
International Union of Crystallography
2013
|
| Assuntos: | |
| Acesso em linha: | https://ncbi.nlm.nih.gov/pmc/articles/PMC4004432/ https://ncbi.nlm.nih.gov/pubmed/24860288 https://ncbi.nlm.nih.govhttp://dx.doi.org/10.1107/S1600536813030389 |
| Tags: |
Adicionar Tag
Sem tags, seja o primeiro a adicionar uma tag!
|